C18H14Cl2N2O — CID 27161017
N-(4-amino-3,5-dichlorophenyl)-2-naphthalen-2-ylacetamide (PubChem CID 27161017) has the molecular formula C18H14Cl2N2O and a molecular weight of 345.23 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-naphthalen-2-ylacetamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-naphthalen-2-ylacetamide |
|---|---|
| PubChem CID | 27161017 |
| Molecular Formula | C18H14Cl2N2O |
| Molecular Weight | 345.23 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-naphthalen-2-ylacetamide |
| SMILES | Nc1c(Cl)cc(NC(=O)Cc2ccc3ccccc3c2)cc1Cl |
| InChI | InChI=1S/C18H14Cl2N2O/c19-15-9-14(10-16(20)18(15)21)22-17(23)8-11-5-6-12-3-1-2-4-13(12)7-11/h1-7,9-10H,8,21H2,(H,22,23) |
| InChIKey | HJTWCZZYKUCQQU-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|