C34H28N2O3 — CID 11214428
N-[2-benzoyl-4-[(2-naphthalen-2-ylacetyl)amino]phenyl]-2-(4-methylphenyl)acetamide (PubChem CID 11214428) has the molecular formula C34H28N2O3 and a molecular weight of 512.61 g/mol. Its IUPAC name is N-[2-benzoyl-4-[(2-naphthalen-2-ylacetyl)amino]phenyl]-2-(4-methylphenyl)acetamide.
| Compound Name | N-[2-benzoyl-4-[(2-naphthalen-2-ylacetyl)amino]phenyl]-2-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 11214428 |
| Molecular Formula | C34H28N2O3 |
| Molecular Weight | 512.61 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | N-[2-benzoyl-4-[(2-naphthalen-2-ylacetyl)amino]phenyl]-2-(4-methylphenyl)acetamide |
| SMILES | Cc1ccc(CC(=O)Nc2ccc(NC(=O)Cc3ccc4ccccc4c3)cc2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H28N2O3/c1-23-11-13-24(14-12-23)20-33(38)36-31-18-17-29(22-30(31)34(39)27-8-3-2-4-9-27)35-32(37)21-25-15-16-26-7-5-6-10-28(26)19-25/h2-19,22H,20-21H2,1H3,(H,35,37)(H,36,38) |
| InChIKey | HJGNPKPFEGVLLZ-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |