C19H16ClNO3S — CID 2902895
3-(4-chlorophenyl)sulfonyl-N-naphthalen-2-ylpropanamide (PubChem CID 2902895) has the molecular formula C19H16ClNO3S and a molecular weight of 373.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-N-naphthalen-2-ylpropanamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-N-naphthalen-2-ylpropanamide |
|---|---|
| PubChem CID | 2902895 |
| Molecular Formula | C19H16ClNO3S |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-N-naphthalen-2-ylpropanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccc(Cl)cc1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H16ClNO3S/c20-16-6-9-18(10-7-16)25(23,24)12-11-19(22)21-17-8-5-14-3-1-2-4-15(14)13-17/h1-10,13H,11-12H2,(H,21,22) |
| InChIKey | DATRQMIOACUVET-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |