C15H13Cl2NO3S — CID 110420604
N-(3-chlorophenyl)-3-(3-chlorophenyl)sulfonylpropanamide (PubChem CID 110420604) has the molecular formula C15H13Cl2NO3S and a molecular weight of 358.25 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(3-chlorophenyl)sulfonylpropanamide.
| Compound Name | N-(3-chlorophenyl)-3-(3-chlorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 110420604 |
| Molecular Formula | C15H13Cl2NO3S |
| Molecular Weight | 358.25 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-(3-chlorophenyl)-3-(3-chlorophenyl)sulfonylpropanamide |
| SMILES | O=C(CCS(=O)(=O)c1cccc(Cl)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2NO3S/c16-11-3-1-5-13(9-11)18-15(19)7-8-22(20,21)14-6-2-4-12(17)10-14/h1-6,9-10H,7-8H2,(H,18,19) |
| InChIKey | KWWXIURUEPQFFS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.25 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |