C17H17ClN2O4S — CID 110423914
N-(4-acetamidophenyl)-3-(3-chlorophenyl)sulfonylpropanamide (PubChem CID 110423914) has the molecular formula C17H17ClN2O4S and a molecular weight of 380.85 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-3-(3-chlorophenyl)sulfonylpropanamide.
| Compound Name | N-(4-acetamidophenyl)-3-(3-chlorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 110423914 |
| Molecular Formula | C17H17ClN2O4S |
| Molecular Weight | 380.85 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | N-(4-acetamidophenyl)-3-(3-chlorophenyl)sulfonylpropanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CCS(=O)(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C17H17ClN2O4S/c1-12(21)19-14-5-7-15(8-6-14)20-17(22)9-10-25(23,24)16-4-2-3-13(18)11-16/h2-8,11H,9-10H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | CGVGVZKRZGMLPB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.85 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |