C15H21ClN2O4S — CID 110609806
N-(4-acetamidobutyl)-3-(3-chlorophenyl)sulfonylpropanamide (PubChem CID 110609806) has the molecular formula C15H21ClN2O4S and a molecular weight of 360.86 g/mol. Its IUPAC name is N-(4-acetamidobutyl)-3-(3-chlorophenyl)sulfonylpropanamide.
| Compound Name | N-(4-acetamidobutyl)-3-(3-chlorophenyl)sulfonylpropanamide |
|---|---|
| PubChem CID | 110609806 |
| Molecular Formula | C15H21ClN2O4S |
| Molecular Weight | 360.86 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-(4-acetamidobutyl)-3-(3-chlorophenyl)sulfonylpropanamide |
| SMILES | CC(=O)NCCCCNC(=O)CCS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H21ClN2O4S/c1-12(19)17-8-2-3-9-18-15(20)7-10-23(21,22)14-6-4-5-13(16)11-14/h4-6,11H,2-3,7-10H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | ZMUHZXRFCYPWRR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.86 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|