C16H16ClNO3S — CID 17310097
3-(benzenesulfonyl)-N-(3-chloro-4-methylphenyl)propanamide (PubChem CID 17310097) has the molecular formula C16H16ClNO3S and a molecular weight of 337.83 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(3-chloro-4-methylphenyl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(3-chloro-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 17310097 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(3-chloro-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCS(=O)(=O)c2ccccc2)cc1Cl |
| InChI | InChI=1S/C16H16ClNO3S/c1-12-7-8-13(11-15(12)17)18-16(19)9-10-22(20,21)14-5-3-2-4-6-14/h2-8,11H,9-10H2,1H3,(H,18,19) |
| InChIKey | WYSVKWWMIJNVTB-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |