C18H21ClN2O — CID 109020626
3-[benzyl(methyl)amino]-N-(3-chloro-4-methylphenyl)propanamide (PubChem CID 109020626) has the molecular formula C18H21ClN2O and a molecular weight of 316.83 g/mol. Its IUPAC name is 3-[benzyl(methyl)amino]-N-(3-chloro-4-methylphenyl)propanamide.
| Compound Name | 3-[benzyl(methyl)amino]-N-(3-chloro-4-methylphenyl)propanamide |
|---|---|
| PubChem CID | 109020626 |
| Molecular Formula | C18H21ClN2O |
| Molecular Weight | 316.83 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 3-[benzyl(methyl)amino]-N-(3-chloro-4-methylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCN(C)Cc2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H21ClN2O/c1-14-8-9-16(12-17(14)19)20-18(22)10-11-21(2)13-15-6-4-3-5-7-15/h3-9,12H,10-11,13H2,1-2H3,(H,20,22) |
| InChIKey | BDIQXWOJPMYUSR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.83 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |