C19H21ClN2O5 — CID 171154533
3-[benzyl(methyl)amino]-N-(3-chlorophenyl)propanamide;oxalic acid (PubChem CID 171154533) has the molecular formula C19H21ClN2O5 and a molecular weight of 392.84 g/mol. Its IUPAC name is 3-[benzyl(methyl)amino]-N-(3-chlorophenyl)propanamide;oxalic acid.
| Compound Name | 3-[benzyl(methyl)amino]-N-(3-chlorophenyl)propanamide;oxalic acid |
|---|---|
| PubChem CID | 171154533 |
| Molecular Formula | C19H21ClN2O5 |
| Molecular Weight | 392.84 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | 3-[benzyl(methyl)amino]-N-(3-chlorophenyl)propanamide;oxalic acid |
| SMILES | CN(CCC(=O)Nc1cccc(Cl)c1)Cc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H19ClN2O.C2H2O4/c1-20(13-14-6-3-2-4-7-14)11-10-17(21)19-16-9-5-8-15(18)12-16;3-1(4)2(5)6/h2-9,12H,10-11,13H2,1H3,(H,19,21);(H,3,4)(H,5,6) |
| InChIKey | UXTIIJUWJSNABS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.84 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|