C18H15ClN2O5S — CID 7544230
3-(4-chlorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide (PubChem CID 7544230) has the molecular formula C18H15ClN2O5S and a molecular weight of 406.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide |
|---|---|
| PubChem CID | 7544230 |
| Molecular Formula | C18H15ClN2O5S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-N-(2-methyl-1,3-dioxoisoindol-5-yl)propanamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)CCS(=O)(=O)c3ccc(Cl)cc3)cc2C1=O |
| InChI | InChI=1S/C18H15ClN2O5S/c1-21-17(23)14-7-4-12(10-15(14)18(21)24)20-16(22)8-9-27(25,26)13-5-2-11(19)3-6-13/h2-7,10H,8-9H2,1H3,(H,20,22) |
| InChIKey | DKYWYZXQAIVNNH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|