C18H16N2O5S — CID 41139582
N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(4-methylsulfonylphenyl)acetamide (PubChem CID 41139582) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(4-methylsulfonylphenyl)acetamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(4-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 41139582 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(4-methylsulfonylphenyl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)Cc3ccc(S(C)(=O)=O)cc3)cc2C1=O |
| InChI | InChI=1S/C18H16N2O5S/c1-20-17(22)14-8-5-12(10-15(14)18(20)23)19-16(21)9-11-3-6-13(7-4-11)26(2,24)25/h3-8,10H,9H2,1-2H3,(H,19,21) |
| InChIKey | BSLSBBVZIRHQFV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|