C15H14N4O3 — CID 171706171
N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(1-methylpyrazol-4-yl)acetamide (PubChem CID 171706171) has the molecular formula C15H14N4O3 and a molecular weight of 298.30 g/mol. Its IUPAC name is N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(1-methylpyrazol-4-yl)acetamide.
| Compound Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(1-methylpyrazol-4-yl)acetamide |
|---|---|
| PubChem CID | 171706171 |
| Molecular Formula | C15H14N4O3 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | N-(2-methyl-1,3-dioxoisoindol-5-yl)-2-(1-methylpyrazol-4-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)Cc3cnn(C)c3)cc2C1=O |
| InChI | InChI=1S/C15H14N4O3/c1-18-8-9(7-16-18)5-13(20)17-10-3-4-11-12(6-10)15(22)19(2)14(11)21/h3-4,6-8H,5H2,1-2H3,(H,17,20) |
| InChIKey | UHHYFMQSDVSXMS-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|