C14H15N3O3 — CID 60661183
2-(cyclopropylamino)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 60661183) has the molecular formula C14H15N3O3 and a molecular weight of 273.29 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-(cyclopropylamino)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 60661183 |
| Molecular Formula | C14H15N3O3 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-(cyclopropylamino)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)CNC3CC3)cc2C1=O |
| InChI | InChI=1S/C14H15N3O3/c1-17-13(19)10-5-4-9(6-11(10)14(17)20)16-12(18)7-15-8-2-3-8/h4-6,8,15H,2-3,7H2,1H3,(H,16,18) |
| InChIKey | AOBSPSONAMPCLD-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|