C17H18F3N3O3 — CID 24664740
1-(2-methyl-1,3-dioxoisoindol-5-yl)-3-[4-(trifluoromethyl)cyclohexyl]urea (PubChem CID 24664740) has the molecular formula C17H18F3N3O3 and a molecular weight of 369.34 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dioxoisoindol-5-yl)-3-[4-(trifluoromethyl)cyclohexyl]urea.
| Compound Name | 1-(2-methyl-1,3-dioxoisoindol-5-yl)-3-[4-(trifluoromethyl)cyclohexyl]urea |
|---|---|
| PubChem CID | 24664740 |
| Molecular Formula | C17H18F3N3O3 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 1-(2-methyl-1,3-dioxoisoindol-5-yl)-3-[4-(trifluoromethyl)cyclohexyl]urea |
| SMILES | CN1C(=O)c2ccc(NC(=O)NC3CCC(C(F)(F)F)CC3)cc2C1=O |
| InChI | InChI=1S/C17H18F3N3O3/c1-23-14(24)12-7-6-11(8-13(12)15(23)25)22-16(26)21-10-4-2-9(3-5-10)17(18,19)20/h6-10H,2-5H2,1H3,(H2,21,22,26) |
| InChIKey | GHXLELAIYLTQTG-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|