C17H23ClN4O3 — CID 119919466
2-[3-(methylamino)piperidin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide;hydrochloride (PubChem CID 119919466) has the molecular formula C17H23ClN4O3 and a molecular weight of 366.85 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide;hydrochloride.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 119919466 |
| Molecular Formula | C17H23ClN4O3 |
| Molecular Weight | 366.85 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide;hydrochloride |
| SMILES | CNC1CCCN(CC(=O)Nc2ccc3c(c2)C(=O)N(C)C3=O)C1.Cl |
| InChI | InChI=1S/C17H22N4O3.ClH/c1-18-12-4-3-7-21(9-12)10-15(22)19-11-5-6-13-14(8-11)17(24)20(2)16(13)23;/h5-6,8,12,18H,3-4,7,9-10H2,1-2H3,(H,19,22);1H |
| InChIKey | WQYQNULGUQSTNK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.85 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|