C16H25N3O3 — CID 119920227
N-(3,4-dimethoxyphenyl)-2-[3-(methylamino)piperidin-1-yl]acetamide (PubChem CID 119920227) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-2-[3-(methylamino)piperidin-1-yl]acetamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-2-[3-(methylamino)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 119920227 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-2-[3-(methylamino)piperidin-1-yl]acetamide |
| SMILES | CNC1CCCN(CC(=O)Nc2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C16H25N3O3/c1-17-13-5-4-8-19(10-13)11-16(20)18-12-6-7-14(21-2)15(9-12)22-3/h6-7,9,13,17H,4-5,8,10-11H2,1-3H3,(H,18,20) |
| InChIKey | WPUGXVQSTGAKLJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |