C13H22Cl2N4O — CID 119918336
2-[3-(methylamino)piperidin-1-yl]-N-pyridin-4-ylacetamide;dihydrochloride (PubChem CID 119918336) has the molecular formula C13H22Cl2N4O and a molecular weight of 321.25 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-N-pyridin-4-ylacetamide;dihydrochloride.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-N-pyridin-4-ylacetamide;dihydrochloride |
|---|---|
| PubChem CID | 119918336 |
| Molecular Formula | C13H22Cl2N4O |
| Molecular Weight | 321.25 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-N-pyridin-4-ylacetamide;dihydrochloride |
| SMILES | CNC1CCCN(CC(=O)Nc2ccncc2)C1.Cl.Cl |
| InChI | InChI=1S/C13H20N4O.2ClH/c1-14-12-3-2-8-17(9-12)10-13(18)16-11-4-6-15-7-5-11;;/h4-7,12,14H,2-3,8-10H2,1H3,(H,15,16,18);2*1H |
| InChIKey | RCSZKUUABMEXSZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.25 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |