C15H21ClF3N3O — CID 119920212
2-[3-(methylamino)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride (PubChem CID 119920212) has the molecular formula C15H21ClF3N3O and a molecular weight of 351.80 g/mol. Its IUPAC name is 2-[3-(methylamino)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride.
| Compound Name | 2-[3-(methylamino)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119920212 |
| Molecular Formula | C15H21ClF3N3O |
| Molecular Weight | 351.80 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 2-[3-(methylamino)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide;hydrochloride |
| SMILES | CNC1CCCN(CC(=O)Nc2cccc(C(F)(F)F)c2)C1.Cl |
| InChI | InChI=1S/C15H20F3N3O.ClH/c1-19-13-6-3-7-21(9-13)10-14(22)20-12-5-2-4-11(8-12)15(16,17)18;/h2,4-5,8,13,19H,3,6-7,9-10H2,1H3,(H,20,22);1H |
| InChIKey | NPKCEUZGKIEXHJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.80 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |