C14H17F3N2O2 — CID 31480654
2-(4-hydroxypiperidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 31480654) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 2-(4-hydroxypiperidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(4-hydroxypiperidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 31480654 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-(4-hydroxypiperidin-1-yl)-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCC(O)CC1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H17F3N2O2/c15-14(16,17)10-2-1-3-11(8-10)18-13(21)9-19-6-4-12(20)5-7-19/h1-3,8,12,20H,4-7,9H2,(H,18,21) |
| InChIKey | ATYAYQLFSGIRMZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |