C15H17F5N2O — CID 166601910
2-[4-(difluoromethyl)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide (PubChem CID 166601910) has the molecular formula C15H17F5N2O and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(difluoromethyl)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 166601910 |
| Molecular Formula | C15H17F5N2O |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-[4-(difluoromethyl)piperidin-1-yl]-N-[3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CN1CCC(C(F)F)CC1)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F5N2O/c16-14(17)10-4-6-22(7-5-10)9-13(23)21-12-3-1-2-11(8-12)15(18,19)20/h1-3,8,10,14H,4-7,9H2,(H,21,23) |
| InChIKey | GZYLEBJPJMFYOX-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |