C16H20N4O3 — CID 119908193
2-(4-aminopiperidin-1-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 119908193) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 2-(4-aminopiperidin-1-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-(4-aminopiperidin-1-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 119908193 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 2-(4-aminopiperidin-1-yl)-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)CN3CCC(N)CC3)cc2C1=O |
| InChI | InChI=1S/C16H20N4O3/c1-19-15(22)12-3-2-11(8-13(12)16(19)23)18-14(21)9-20-6-4-10(17)5-7-20/h2-3,8,10H,4-7,9,17H2,1H3,(H,18,21) |
| InChIKey | OEGYGBLUPCHHMK-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|