C23H21ClN4O4 — CID 55837853
2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide (PubChem CID 55837853) has the molecular formula C23H21ClN4O4 and a molecular weight of 452.90 g/mol. Its IUPAC name is 2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide.
| Compound Name | 2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
|---|---|
| PubChem CID | 55837853 |
| Molecular Formula | C23H21ClN4O4 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.13 |
| IUPAC Name | 2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]-N-(2-methyl-1,3-dioxoisoindol-5-yl)acetamide |
| SMILES | CN1C(=O)c2ccc(NC(=O)CN3CCC(c4nc5cc(Cl)ccc5o4)CC3)cc2C1=O |
| InChI | InChI=1S/C23H21ClN4O4/c1-27-22(30)16-4-3-15(11-17(16)23(27)31)25-20(29)12-28-8-6-13(7-9-28)21-26-18-10-14(24)2-5-19(18)32-21/h2-5,10-11,13H,6-9,12H2,1H3,(H,25,29) |
| InChIKey | BFUSGRUJYCKLEO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 95.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|