C20H18BrClN4O4 — CID 55838364
N-(2-bromo-4-nitrophenyl)-2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]acetamide (PubChem CID 55838364) has the molecular formula C20H18BrClN4O4 and a molecular weight of 493.75 g/mol. Its IUPAC name is N-(2-bromo-4-nitrophenyl)-2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]acetamide.
| Compound Name | N-(2-bromo-4-nitrophenyl)-2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 55838364 |
| Molecular Formula | C20H18BrClN4O4 |
| Molecular Weight | 493.75 g/mol |
| Exact Mass | 492.02 |
| IUPAC Name | N-(2-bromo-4-nitrophenyl)-2-[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]acetamide |
| SMILES | O=C(CN1CCC(c2nc3cc(Cl)ccc3o2)CC1)Nc1ccc([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C20H18BrClN4O4/c21-15-10-14(26(28)29)2-3-16(15)23-19(27)11-25-7-5-12(6-8-25)20-24-17-9-13(22)1-4-18(17)30-20/h1-4,9-10,12H,5-8,11H2,(H,23,27) |
| InChIKey | COCASNODKAPJAP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.75 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|