C20H19ClN2O3 — CID 122028708
3-[[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]methyl]benzoic acid (PubChem CID 122028708) has the molecular formula C20H19ClN2O3 and a molecular weight of 370.84 g/mol. Its IUPAC name is 3-[[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122028708 |
| Molecular Formula | C20H19ClN2O3 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 3-[[4-(5-chloro-1,3-benzoxazol-2-yl)piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCC(c3nc4cc(Cl)ccc4o3)CC2)c1 |
| InChI | InChI=1S/C20H19ClN2O3/c21-16-4-5-18-17(11-16)22-19(26-18)14-6-8-23(9-7-14)12-13-2-1-3-15(10-13)20(24)25/h1-5,10-11,14H,6-9,12H2,(H,24,25) |
| InChIKey | JSUPZMZLPORXQQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 66.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |