C19H20ClNO2S — CID 122029319
3-[[4-(4-chlorophenyl)sulfanylpiperidin-1-yl]methyl]benzoic acid (PubChem CID 122029319) has the molecular formula C19H20ClNO2S and a molecular weight of 361.89 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)sulfanylpiperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-(4-chlorophenyl)sulfanylpiperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 122029319 |
| Molecular Formula | C19H20ClNO2S |
| Molecular Weight | 361.89 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)sulfanylpiperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCC(Sc3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C19H20ClNO2S/c20-16-4-6-17(7-5-16)24-18-8-10-21(11-9-18)13-14-2-1-3-15(12-14)19(22)23/h1-7,12,18H,8-11,13H2,(H,22,23) |
| InChIKey | NOLZLNUIANYWRY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.89 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |