C26H27NO3 — CID 118717670
3-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]benzoic acid (PubChem CID 118717670) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 3-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]benzoic acid.
| Compound Name | 3-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 118717670 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | 3-[[4-[hydroxy(diphenyl)methyl]piperidin-1-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1cccc(CN2CCC(C(O)(c3ccccc3)c3ccccc3)CC2)c1 |
| InChI | InChI=1S/C26H27NO3/c28-25(29)21-9-7-8-20(18-21)19-27-16-14-24(15-17-27)26(30,22-10-3-1-4-11-22)23-12-5-2-6-13-23/h1-13,18,24,30H,14-17,19H2,(H,28,29) |
| InChIKey | HNDCVUYSRWGVQO-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |