C34H35NO6 — CID 163328691
diphenyl-[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]methanol;oxalic acid (PubChem CID 163328691) has the molecular formula C34H35NO6 and a molecular weight of 553.66 g/mol. Its IUPAC name is diphenyl-[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]methanol;oxalic acid.
| Compound Name | diphenyl-[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]methanol;oxalic acid |
|---|---|
| PubChem CID | 163328691 |
| Molecular Formula | C34H35NO6 |
| Molecular Weight | 553.66 g/mol |
| Exact Mass | 553.25 |
| IUPAC Name | diphenyl-[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]methanol;oxalic acid |
| SMILES | O=C(O)C(=O)O.OC(c1ccccc1)(c1ccccc1)C1CCN(Cc2cccc(OCc3ccccc3)c2)CC1 |
| InChI | InChI=1S/C32H33NO2.C2H2O4/c34-32(28-14-6-2-7-15-28,29-16-8-3-9-17-29)30-19-21-33(22-20-30)24-27-13-10-18-31(23-27)35-25-26-11-4-1-5-12-26;3-1(4)2(5)6/h1-18,23,30,34H,19-22,24-25H2;(H,3,4)(H,5,6) |
| InChIKey | XRQQGDIJSBXYRY-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 107.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|