C22H26N2O6 — CID 23724163
oxalic acid;1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 23724163) has the molecular formula C22H26N2O6 and a molecular weight of 414.46 g/mol. Its IUPAC name is oxalic acid;1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | oxalic acid;1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 23724163 |
| Molecular Formula | C22H26N2O6 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | oxalic acid;1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(Cc2cccc(OCc3ccccc3)c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H24N2O2.C2H2O4/c21-20(23)18-9-11-22(12-10-18)14-17-7-4-8-19(13-17)24-15-16-5-2-1-3-6-16;3-1(4)2(5)6/h1-8,13,18H,9-12,14-15H2,(H2,21,23);(H,3,4)(H,5,6) |
| InChIKey | LUZCXDCNZWGPBY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 130.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|