C33H40N2O6 — CID 163328501
N-benzyl-N-butyl-1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid (PubChem CID 163328501) has the molecular formula C33H40N2O6 and a molecular weight of 560.69 g/mol. Its IUPAC name is N-benzyl-N-butyl-1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid.
| Compound Name | N-benzyl-N-butyl-1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 163328501 |
| Molecular Formula | C33H40N2O6 |
| Molecular Weight | 560.69 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | N-benzyl-N-butyl-1-[(3-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid |
| SMILES | CCCCN(Cc1ccccc1)C(=O)C1CCN(Cc2cccc(OCc3ccccc3)c2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C31H38N2O2.C2H2O4/c1-2-3-19-33(24-26-11-6-4-7-12-26)31(34)29-17-20-32(21-18-29)23-28-15-10-16-30(22-28)35-25-27-13-8-5-9-14-27;3-1(4)2(5)6/h4-16,22,29H,2-3,17-21,23-25H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | NCOCJSLZXCEASD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.69 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|