C26H32N2O6 — CID 163328359
oxalic acid;[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone (PubChem CID 163328359) has the molecular formula C26H32N2O6 and a molecular weight of 468.55 g/mol. Its IUPAC name is oxalic acid;[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | oxalic acid;[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 163328359 |
| Molecular Formula | C26H32N2O6 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.23 |
| IUPAC Name | oxalic acid;[1-[(3-phenylmethoxyphenyl)methyl]piperidin-4-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(C1CCN(Cc2cccc(OCc3ccccc3)c2)CC1)N1CCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H30N2O2.C2H2O4/c27-24(26-13-4-5-14-26)22-11-15-25(16-12-22)18-21-9-6-10-23(17-21)28-19-20-7-2-1-3-8-20;3-1(4)2(5)6/h1-3,6-10,17,22H,4-5,11-16,18-19H2;(H,3,4)(H,5,6) |
| InChIKey | ZYCAJILWRHDUKP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|