C27H34N2O6 — CID 90484118
azepan-1-yl-[1-[(3-phenoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid (PubChem CID 90484118) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is azepan-1-yl-[1-[(3-phenoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid.
| Compound Name | azepan-1-yl-[1-[(3-phenoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 90484118 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | azepan-1-yl-[1-[(3-phenoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid |
| SMILES | O=C(C1CCCN(Cc2cccc(Oc3ccccc3)c2)C1)N1CCCCCC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H32N2O2.C2H2O4/c28-25(27-16-6-1-2-7-17-27)22-11-9-15-26(20-22)19-21-10-8-14-24(18-21)29-23-12-4-3-5-13-23;3-1(4)2(5)6/h3-5,8,10,12-14,18,22H,1-2,6-7,9,11,15-17,19-20H2;(H,3,4)(H,5,6) |
| InChIKey | ORSTZHUGTIBMJS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|