C26H34N2O2 — CID 40640492
(4-benzylpiperidin-1-yl)-[(3R)-1-[(3-methoxyphenyl)methyl]piperidin-3-yl]methanone (PubChem CID 40640492) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[(3R)-1-[(3-methoxyphenyl)methyl]piperidin-3-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[(3R)-1-[(3-methoxyphenyl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 40640492 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[(3R)-1-[(3-methoxyphenyl)methyl]piperidin-3-yl]methanone |
| SMILES | COc1cccc(CN2CCC[C@@H](C(=O)N3CCC(Cc4ccccc4)CC3)C2)c1 |
| InChI | InChI=1S/C26H34N2O2/c1-30-25-11-5-9-23(18-25)19-27-14-6-10-24(20-27)26(29)28-15-12-22(13-16-28)17-21-7-3-2-4-8-21/h2-5,7-9,11,18,22,24H,6,10,12-17,19-20H2,1H3/t24-/m1/s1 |
| InChIKey | SBJJZCTXAHQMMQ-XMMPIXPASA-N |
| XLogP | 4.39 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |