C25H31N3O3 — CID 7344095
(4-benzylpiperidin-1-yl)-[(3R)-1-[(2-nitrophenyl)methyl]piperidin-3-yl]methanone (PubChem CID 7344095) has the molecular formula C25H31N3O3 and a molecular weight of 421.54 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[(3R)-1-[(2-nitrophenyl)methyl]piperidin-3-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[(3R)-1-[(2-nitrophenyl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 7344095 |
| Molecular Formula | C25H31N3O3 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[(3R)-1-[(2-nitrophenyl)methyl]piperidin-3-yl]methanone |
| SMILES | O=C([C@@H]1CCCN(Cc2ccccc2[N+](=O)[O-])C1)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H31N3O3/c29-25(27-15-12-21(13-16-27)17-20-7-2-1-3-8-20)23-10-6-14-26(19-23)18-22-9-4-5-11-24(22)28(30)31/h1-5,7-9,11,21,23H,6,10,12-19H2/t23-/m1/s1 |
| InChIKey | RRNFHZCXJJIUDR-HSZRJFAPSA-N |
| XLogP | 4.29 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|