C27H36N2O — CID 3482407
(4-benzylpiperidin-1-yl)-[1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanone (PubChem CID 3482407) has the molecular formula C27H36N2O and a molecular weight of 404.60 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanone.
| Compound Name | (4-benzylpiperidin-1-yl)-[1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 3482407 |
| Molecular Formula | C27H36N2O |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[1-[(4-ethylphenyl)methyl]piperidin-3-yl]methanone |
| SMILES | CCc1ccc(CN2CCCC(C(=O)N3CCC(Cc4ccccc4)CC3)C2)cc1 |
| InChI | InChI=1S/C27H36N2O/c1-2-22-10-12-25(13-11-22)20-28-16-6-9-26(21-28)27(30)29-17-14-24(15-18-29)19-23-7-4-3-5-8-23/h3-5,7-8,10-13,24,26H,2,6,9,14-21H2,1H3 |
| InChIKey | NLHNAFQMEUFEJE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |