C25H32N2O5 — CID 90483616
N-benzyl-1-[(4-ethylphenyl)methyl]-N-methylpiperidine-3-carboxamide;oxalic acid (PubChem CID 90483616) has the molecular formula C25H32N2O5 and a molecular weight of 440.54 g/mol. Its IUPAC name is N-benzyl-1-[(4-ethylphenyl)methyl]-N-methylpiperidine-3-carboxamide;oxalic acid.
| Compound Name | N-benzyl-1-[(4-ethylphenyl)methyl]-N-methylpiperidine-3-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 90483616 |
| Molecular Formula | C25H32N2O5 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.23 |
| IUPAC Name | N-benzyl-1-[(4-ethylphenyl)methyl]-N-methylpiperidine-3-carboxamide;oxalic acid |
| SMILES | CCc1ccc(CN2CCCC(C(=O)N(C)Cc3ccccc3)C2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H30N2O.C2H2O4/c1-3-19-11-13-21(14-12-19)17-25-15-7-10-22(18-25)23(26)24(2)16-20-8-5-4-6-9-20;3-1(4)2(5)6/h4-6,8-9,11-14,22H,3,7,10,15-18H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | BYIVNIJCSHMOSO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|