C35H42N2O7 — CID 90483542
(4-benzylpiperidin-1-yl)-[1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid (PubChem CID 90483542) has the molecular formula C35H42N2O7 and a molecular weight of 602.73 g/mol. Its IUPAC name is (4-benzylpiperidin-1-yl)-[1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid.
| Compound Name | (4-benzylpiperidin-1-yl)-[1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 90483542 |
| Molecular Formula | C35H42N2O7 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.30 |
| IUPAC Name | (4-benzylpiperidin-1-yl)-[1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid |
| SMILES | COc1cc(CN2CCCC(C(=O)N3CCC(Cc4ccccc4)CC3)C2)ccc1OCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C33H40N2O3.C2H2O4/c1-37-32-22-29(14-15-31(32)38-25-28-11-6-3-7-12-28)23-34-18-8-13-30(24-34)33(36)35-19-16-27(17-20-35)21-26-9-4-2-5-10-26;3-1(4)2(5)6/h2-7,9-12,14-15,22,27,30H,8,13,16-21,23-25H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | XUUUNRADBNREPP-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|