C29H38N2O7 — CID 2933537
azepan-1-yl-[1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid (PubChem CID 2933537) has the molecular formula C29H38N2O7 and a molecular weight of 526.63 g/mol. Its IUPAC name is azepan-1-yl-[1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid.
| Compound Name | azepan-1-yl-[1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid |
|---|---|
| PubChem CID | 2933537 |
| Molecular Formula | C29H38N2O7 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | azepan-1-yl-[1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidin-3-yl]methanone;oxalic acid |
| SMILES | COc1cc(CN2CCCC(C(=O)N3CCCCCC3)C2)ccc1OCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C27H36N2O3.C2H2O4/c1-31-26-18-23(13-14-25(26)32-21-22-10-5-4-6-11-22)19-28-15-9-12-24(20-28)27(30)29-16-7-2-3-8-17-29;3-1(4)2(5)6/h4-6,10-11,13-14,18,24H,2-3,7-9,12,15-17,19-21H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | ZGEMPWYKKVYERI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|