C23H28N2O7 — CID 23724334
1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid (PubChem CID 23724334) has the molecular formula C23H28N2O7 and a molecular weight of 444.48 g/mol. Its IUPAC name is 1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid.
| Compound Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 23724334 |
| Molecular Formula | C23H28N2O7 |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidine-4-carboxamide;oxalic acid |
| SMILES | COc1cc(CN2CCC(C(N)=O)CC2)ccc1OCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C21H26N2O3.C2H2O4/c1-25-20-13-17(14-23-11-9-18(10-12-23)21(22)24)7-8-19(20)26-15-16-5-3-2-4-6-16;3-1(4)2(5)6/h2-8,13,18H,9-12,14-15H2,1H3,(H2,22,24);(H,3,4)(H,5,6) |
| InChIKey | QSZXBLARPSNFPT-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 139.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|