C25H32N2O7 — CID 163328607
N-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide;oxalic acid (PubChem CID 163328607) has the molecular formula C25H32N2O7 and a molecular weight of 472.54 g/mol. Its IUPAC name is N-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide;oxalic acid.
| Compound Name | N-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 163328607 |
| Molecular Formula | C25H32N2O7 |
| Molecular Weight | 472.54 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | N-benzyl-1-[(3,4-dimethoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide;oxalic acid |
| SMILES | COc1ccc(CN2CCC(C(=O)N(C)Cc3ccccc3)CC2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H30N2O3.C2H2O4/c1-24(16-18-7-5-4-6-8-18)23(26)20-11-13-25(14-12-20)17-19-9-10-21(27-2)22(15-19)28-3;3-1(4)2(5)6/h4-10,15,20H,11-14,16-17H2,1-3H3;(H,3,4)(H,5,6) |
| InChIKey | UNOHOIQRPUUBPS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|