C27H36N2O9 — CID 163328069
N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2-hydroxy-3-methoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide;oxalic acid (PubChem CID 163328069) has the molecular formula C27H36N2O9 and a molecular weight of 532.59 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2-hydroxy-3-methoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide;oxalic acid.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2-hydroxy-3-methoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 163328069 |
| Molecular Formula | C27H36N2O9 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[(2-hydroxy-3-methoxyphenyl)methyl]-N-methylpiperidine-4-carboxamide;oxalic acid |
| SMILES | COc1ccc(CCN(C)C(=O)C2CCN(Cc3cccc(OC)c3O)CC2)cc1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H34N2O5.C2H2O4/c1-26(13-10-18-8-9-21(30-2)23(16-18)32-4)25(29)19-11-14-27(15-12-19)17-20-6-5-7-22(31-3)24(20)28;3-1(4)2(5)6/h5-9,16,19,28H,10-15,17H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | NDMFSYBHEFFZPW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|