C21H32N2O7 — CID 123132441
1-[(2,3-dimethoxyphenyl)methyl]-N,N-diethylpiperidine-4-carboxamide;oxalic acid (PubChem CID 123132441) has the molecular formula C21H32N2O7 and a molecular weight of 424.49 g/mol. Its IUPAC name is 1-[(2,3-dimethoxyphenyl)methyl]-N,N-diethylpiperidine-4-carboxamide;oxalic acid.
| Compound Name | 1-[(2,3-dimethoxyphenyl)methyl]-N,N-diethylpiperidine-4-carboxamide;oxalic acid |
|---|---|
| PubChem CID | 123132441 |
| Molecular Formula | C21H32N2O7 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | 1-[(2,3-dimethoxyphenyl)methyl]-N,N-diethylpiperidine-4-carboxamide;oxalic acid |
| SMILES | CCN(CC)C(=O)C1CCN(Cc2cccc(OC)c2OC)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C19H30N2O3.C2H2O4/c1-5-21(6-2)19(22)15-10-12-20(13-11-15)14-16-8-7-9-17(23-3)18(16)24-4;3-1(4)2(5)6/h7-9,15H,5-6,10-14H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | YZQHGGZDDWTDKN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 116.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|