C18H26N2O8 — CID 163326830
oxalic acid;1-[(2,3,4-trimethoxyphenyl)methyl]piperidine-4-carboxamide (PubChem CID 163326830) has the molecular formula C18H26N2O8 and a molecular weight of 398.41 g/mol. Its IUPAC name is oxalic acid;1-[(2,3,4-trimethoxyphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | oxalic acid;1-[(2,3,4-trimethoxyphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 163326830 |
| Molecular Formula | C18H26N2O8 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | oxalic acid;1-[(2,3,4-trimethoxyphenyl)methyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(CN2CCC(C(N)=O)CC2)c(OC)c1OC.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H24N2O4.C2H2O4/c1-20-13-5-4-12(14(21-2)15(13)22-3)10-18-8-6-11(7-9-18)16(17)19;3-1(4)2(5)6/h4-5,11H,6-10H2,1-3H3,(H2,17,19);(H,3,4)(H,5,6) |
| InChIKey | HRMZIZIVJMHVHX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 148.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|