C31H38N2O9 — CID 2880183
1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;oxalic acid (PubChem CID 2880183) has the molecular formula C31H38N2O9 and a molecular weight of 582.65 g/mol. Its IUPAC name is 1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;oxalic acid.
| Compound Name | 1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;oxalic acid |
|---|---|
| PubChem CID | 2880183 |
| Molecular Formula | C31H38N2O9 |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.26 |
| IUPAC Name | 1-[(4-methoxy-3-phenylmethoxyphenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine;oxalic acid |
| SMILES | COc1ccc(CN2CCN(Cc3ccc(OC)c(OC)c3OC)CC2)cc1OCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H36N2O5.C2H2O4/c1-32-25-12-10-23(18-27(25)36-21-22-8-6-5-7-9-22)19-30-14-16-31(17-15-30)20-24-11-13-26(33-2)29(35-4)28(24)34-3;3-1(4)2(5)6/h5-13,18H,14-17,19-21H2,1-4H3;(H,3,4)(H,5,6) |
| InChIKey | VSMXQXVBLADDMR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 127.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|