C22H27NO6 — CID 23724207
1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidine;oxalic acid (PubChem CID 23724207) has the molecular formula C22H27NO6 and a molecular weight of 401.46 g/mol. Its IUPAC name is 1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidine;oxalic acid.
| Compound Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidine;oxalic acid |
|---|---|
| PubChem CID | 23724207 |
| Molecular Formula | C22H27NO6 |
| Molecular Weight | 401.46 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 1-[(3-methoxy-4-phenylmethoxyphenyl)methyl]piperidine;oxalic acid |
| SMILES | COc1cc(CN2CCCCC2)ccc1OCc1ccccc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H25NO2.C2H2O4/c1-22-20-14-18(15-21-12-6-3-7-13-21)10-11-19(20)23-16-17-8-4-2-5-9-17;3-1(4)2(5)6/h2,4-5,8-11,14H,3,6-7,12-13,15-16H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | UYUBLCJRPJXPCC-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|