C16H25NO3 — CID 23736534
1-[(2,3,4-trimethoxyphenyl)methyl]azepane (PubChem CID 23736534) has the molecular formula C16H25NO3 and a molecular weight of 279.38 g/mol. Its IUPAC name is 1-[(2,3,4-trimethoxyphenyl)methyl]azepane.
| Compound Name | 1-[(2,3,4-trimethoxyphenyl)methyl]azepane |
|---|---|
| PubChem CID | 23736534 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 1-[(2,3,4-trimethoxyphenyl)methyl]azepane |
| SMILES | COc1ccc(CN2CCCCCC2)c(OC)c1OC |
| InChI | InChI=1S/C16H25NO3/c1-18-14-9-8-13(15(19-2)16(14)20-3)12-17-10-6-4-5-7-11-17/h8-9H,4-7,10-12H2,1-3H3 |
| InChIKey | BHXZTZMHVZCHSY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |