C17H28N2O3 — CID 51073742
1-propyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine (PubChem CID 51073742) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-propyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-propyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 51073742 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-propyl-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| SMILES | CCCN1CCN(Cc2ccc(OC)c(OC)c2OC)CC1 |
| InChI | InChI=1S/C17H28N2O3/c1-5-8-18-9-11-19(12-10-18)13-14-6-7-15(20-2)17(22-4)16(14)21-3/h6-7H,5,8-13H2,1-4H3 |
| InChIKey | JWFDOSMBPXPFHY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |