C21H34N2O3 — CID 1148357
1-(4-methylcyclohexyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine (PubChem CID 1148357) has the molecular formula C21H34N2O3 and a molecular weight of 362.51 g/mol. Its IUPAC name is 1-(4-methylcyclohexyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine.
| Compound Name | 1-(4-methylcyclohexyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
|---|---|
| PubChem CID | 1148357 |
| Molecular Formula | C21H34N2O3 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.26 |
| IUPAC Name | 1-(4-methylcyclohexyl)-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine |
| SMILES | COc1ccc(CN2CCN(C3CCC(C)CC3)CC2)c(OC)c1OC |
| InChI | InChI=1S/C21H34N2O3/c1-16-5-8-18(9-6-16)23-13-11-22(12-14-23)15-17-7-10-19(24-2)21(26-4)20(17)25-3/h7,10,16,18H,5-6,8-9,11-15H2,1-4H3 |
| InChIKey | HYQRSXMFOHYRMY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |