C14H21NO4 — CID 782614
4-[(2,3,4-trimethoxyphenyl)methyl]morpholine (PubChem CID 782614) has the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-[(2,3,4-trimethoxyphenyl)methyl]morpholine.
| Compound Name | 4-[(2,3,4-trimethoxyphenyl)methyl]morpholine |
|---|---|
| PubChem CID | 782614 |
| Molecular Formula | C14H21NO4 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[(2,3,4-trimethoxyphenyl)methyl]morpholine |
| SMILES | COc1ccc(CN2CCOCC2)c(OC)c1OC |
| InChI | InChI=1S/C14H21NO4/c1-16-12-5-4-11(13(17-2)14(12)18-3)10-15-6-8-19-9-7-15/h4-5H,6-10H2,1-3H3 |
| InChIKey | MGVIMZSLIDSZKZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |