C17H30Cl2N2O4 — CID 6457021
3-morpholin-4-yl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine;dihydrochloride (PubChem CID 6457021) has the molecular formula C17H30Cl2N2O4 and a molecular weight of 397.34 g/mol. Its IUPAC name is 3-morpholin-4-yl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine;dihydrochloride.
| Compound Name | 3-morpholin-4-yl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 6457021 |
| Molecular Formula | C17H30Cl2N2O4 |
| Molecular Weight | 397.34 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 3-morpholin-4-yl-N-[(2,3,4-trimethoxyphenyl)methyl]propan-1-amine;dihydrochloride |
| SMILES | COc1ccc(CNCCCN2CCOCC2)c(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C17H28N2O4.2ClH/c1-20-15-6-5-14(16(21-2)17(15)22-3)13-18-7-4-8-19-9-11-23-12-10-19;;/h5-6,18H,4,7-13H2,1-3H3;2*1H |
| InChIKey | KADJDUQCNGOLGU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|