C19H26ClN2O2- — CID 53350960
N-[(2-methoxynaphthalen-1-yl)methyl]-3-morpholin-4-ylpropan-1-amine chloride (PubChem CID 53350960) has the molecular formula C19H26ClN2O2- and a molecular weight of 349.88 g/mol. Its IUPAC name is N-[(2-methoxynaphthalen-1-yl)methyl]-3-morpholin-4-ylpropan-1-amine chloride.
| Compound Name | N-[(2-methoxynaphthalen-1-yl)methyl]-3-morpholin-4-ylpropan-1-amine chloride |
|---|---|
| PubChem CID | 53350960 |
| Molecular Formula | C19H26ClN2O2- |
| Molecular Weight | 349.88 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-[(2-methoxynaphthalen-1-yl)methyl]-3-morpholin-4-ylpropan-1-amine chloride |
| SMILES | COc1ccc2ccccc2c1CNCCCN1CCOCC1.[Cl-] |
| InChI | InChI=1S/C19H26N2O2.ClH/c1-22-19-8-7-16-5-2-3-6-17(16)18(19)15-20-9-4-10-21-11-13-23-14-12-21;/h2-3,5-8,20H,4,9-15H2,1H3;1H/p-1 |
| InChIKey | WCGPAPQQVWNYTJ-UHFFFAOYSA-M |
| XLogP | -0.34 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.88 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|